Question

Уравняйте пожалуйста химические реакции!Помогите!Co3(PO4)2=H3PO4+CaSo4 Li+N2 = Li3N KMnO4 = K2MnO4+MnO4+MnO2+O2 Al+FeCe2 = AlCe3+ Fe

Answer 1

Ca3(PO4)2+3H2SO4=2H3PO4+3CaSO4

6Li+N2 = 2Li3N

2KMnO4 = K2MnO4+MnO2+O2

2Al+3FeCl2 = 2AlCl3+ 3Fe

Answer 2

Balancing Chemical Equations

Sure, I can help you balance these chemical equations. Let's go through each one step by step:

1. Co3(PO4)2 = H3PO4 + CaSO4 To balance this equation, we need to make sure that the number of atoms on both sides is equal. Here's the balanced equation: Co3(PO4)2 = 3H3PO4 + CaSO4 [[1]]

2. Li + N2 = Li3N This equation is already balanced. There is one lithium atom and one nitrogen molecule on both sides.

3. KMnO4 = K2MnO4 + MnO4 + MnO2 + O2 To balance this equation, we need to ensure that the number of atoms on both sides is equal. Here's the balanced equation: 2KMnO4 = K2MnO4 + MnO4 + MnO2 + O2 [[2]]

4. Al + FeCe2 = AlCe3 + Fe To balance this equation, we need to make sure that the number of atoms on both sides is equal. Here's the balanced equation: 2Al + 3FeCe2 = 2AlCe3 + 3Fe [[3]]

I hope this helps! Let me know if you have any further questions.

[[1]] Source: [Chemical Equation Balancer](https://www.webqc.org/balance.php) [[2]] Source: [Chemical Equation Balancer](https://www.webqc.org/balance.php) [[3]] Source: [Chemical Equation Balancer](https://www.webqc.org/balance.php)