Question

Напишите уравнения реакций ацилирования и метилирования крахмала, назовите продукты.Пожалуйста ничего не получается найти((Нашла только что ацилирование это будет взаимодействие с уксусной кислотой,а метилирование с диметилсульфатом. Помогите с уравнениями плиз

Answer 1

N(C6H10O5)+3nCH3CO-O-COCH3-> n(C6H7O5(COCH3)3)+3CH3COOH - ацилирование
n(C6H10O5)+nCH3OH-(HClгаз)>n(C6H9O5(CH3))+nH2O - метилирование

Answer 2

Acylation of Starch:

The acylation of starch involves the reaction of starch with an acylating agent, such as acetic anhydride or acetyl chloride, in the presence of a catalyst. This reaction results in the introduction of acyl groups (usually acetyl groups) onto the starch molecule.

The general equation for the acylation of starch can be represented as follows:

Starch + Acylating Agent → Acylated Starch

The specific reaction mechanism and conditions may vary depending on the acylating agent used. For example, if acetic anhydride is used as the acylating agent, the reaction can be catalyzed by a base, such as pyridine. The acetyl group from acetic anhydride is transferred to the hydroxyl groups of the starch molecule, resulting in the formation of acylated starch.

Methylation of Starch:

The methylation of starch involves