Question

1)CH3-CH2-CH(СН3)-CH(СН3)-СН2-CООН + Ba 2)CH3-CH2-CH(СН3)-CH(СН3)-СН2-CООН + KOH 3)CH3-CH2-CH(СН3)-CH(СН3)-СН2-CООН + H2

Answer 1

Ответ указан на фото

Answer 2

It seems like you provided three chemical reactions, but they lack complete information. The reactions are written in a general format, and we need specific reagents and conditions to determine the products. Without further details, I can provide some possibilities for the reactions based on common reactions involving similar compounds.

1. CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + Ba This reaction appears to involve a carboxylic acid (CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH) reacting with barium (Ba). In this case, a carboxylic acid can undergo an acid-base reaction with a metal to form a salt and hydrogen gas.

Possible reaction: CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + Ba → Ba(CH3-CH2-CH(CH3)-CH(CH3)-CH2-COO) + H2↑

2. CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + KOH This reaction involves a carboxylic acid (CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH) reacting with potassium hydroxide (KOH). Carboxylic acids can undergo an acid-base reaction with bases like KOH to form a salt and water.

Possible reaction: CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + KOH → CH3-CH2-CH(CH3)-CH(CH3)-CH2-COO-K+ + H2O

3. CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + H2 This reaction involves a carboxylic acid (CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH) reacting with hydrogen gas (H2). In the presence of a catalyst, such as a metal catalyst like palladium (Pd) or platinum (Pt), carboxylic acids can undergo hydrogenation reactions to produce alcohols.

Possible reaction: CH3-CH2-CH(CH3)-CH(CH3)-CH2-COOH + H2 → CH3-CH2-CH(CH3)-CH(CH3)-CH2-CH2OH

Please note that these reactions are based on the general information provided. The specific conditions, reagents, and catalysts used in the reactions can significantly affect the outcome. If you have more detailed information about the reactions, I can provide a more accurate prediction.